C30H38N2O3S — CID 123764668
2-[benzylsulfonyl(2-methylhepta-1,3,5-trien-4-yl)amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide (PubChem CID 123764668) has the molecular formula C30H38N2O3S and a molecular weight of 506.71 g/mol. Its IUPAC name is 2-[benzylsulfonyl(2-methylhepta-1,3,5-trien-4-yl)amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide.
| Compound Name | 2-[benzylsulfonyl(2-methylhepta-1,3,5-trien-4-yl)amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 123764668 |
| Molecular Formula | C30H38N2O3S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 2-[benzylsulfonyl(2-methylhepta-1,3,5-trien-4-yl)amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide |
| SMILES | C=C(C)C=C(C=CC)N(C(C(=O)NC1CCCCC1)c1ccccc1C)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C30H38N2O3S/c1-5-14-27(21-23(2)3)32(36(34,35)22-25-16-8-6-9-17-25)29(28-20-13-12-15-24(28)4)30(33)31-26-18-10-7-11-19-26/h5-6,8-9,12-17,20-21,26,29H,2,7,10-11,18-19,22H2,1,3-4H3,(H,31,33) |
| InChIKey | ARENKZHSZQYVIZ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|