C31H38FN3O2 — CID 123315156
N-cyclohexyl-2-[[2-(4-fluoroanilino)acetyl]-(2-methylhepta-1,3,5-trien-4-yl)amino]-2-(2-methylphenyl)acetamide (PubChem CID 123315156) has the molecular formula C31H38FN3O2 and a molecular weight of 503.66 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(4-fluoroanilino)acetyl]-(2-methylhepta-1,3,5-trien-4-yl)amino]-2-(2-methylphenyl)acetamide.
| Compound Name | N-cyclohexyl-2-[[2-(4-fluoroanilino)acetyl]-(2-methylhepta-1,3,5-trien-4-yl)amino]-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 123315156 |
| Molecular Formula | C31H38FN3O2 |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | N-cyclohexyl-2-[[2-(4-fluoroanilino)acetyl]-(2-methylhepta-1,3,5-trien-4-yl)amino]-2-(2-methylphenyl)acetamide |
| SMILES | C=C(C)C=C(C=CC)N(C(=O)CNc1ccc(F)cc1)C(C(=O)NC1CCCCC1)c1ccccc1C |
| InChI | InChI=1S/C31H38FN3O2/c1-5-11-27(20-22(2)3)35(29(36)21-33-25-18-16-24(32)17-19-25)30(28-15-10-9-12-23(28)4)31(37)34-26-13-7-6-8-14-26/h5,9-12,15-20,26,30,33H,2,6-8,13-14,21H2,1,3-4H3,(H,34,37) |
| InChIKey | ZYFHGINRQKWHHR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|