C27H34FN3O2 — CID 71457355
N-cyclohexyl-2-(3-fluoro-N-(2-pyrrolidin-1-ylacetyl)anilino)-2-(2-methylphenyl)acetamide (PubChem CID 71457355) has the molecular formula C27H34FN3O2 and a molecular weight of 451.59 g/mol. Its IUPAC name is N-cyclohexyl-2-(3-fluoro-N-(2-pyrrolidin-1-ylacetyl)anilino)-2-(2-methylphenyl)acetamide.
| Compound Name | N-cyclohexyl-2-(3-fluoro-N-(2-pyrrolidin-1-ylacetyl)anilino)-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 71457355 |
| Molecular Formula | C27H34FN3O2 |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | N-cyclohexyl-2-(3-fluoro-N-(2-pyrrolidin-1-ylacetyl)anilino)-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1C(C(=O)NC1CCCCC1)N(C(=O)CN1CCCC1)c1cccc(F)c1 |
| InChI | InChI=1S/C27H34FN3O2/c1-20-10-5-6-15-24(20)26(27(33)29-22-12-3-2-4-13-22)31(23-14-9-11-21(28)18-23)25(32)19-30-16-7-8-17-30/h5-6,9-11,14-15,18,22,26H,2-4,7-8,12-13,16-17,19H2,1H3,(H,29,33) |
| InChIKey | UINCVEDSEWVFSU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |