C30H27ClFN3O4 — CID 137496984
2-(2-chlorophenyl)-N-cyclohexyl-2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-3-fluoroanilino)acetamide (PubChem CID 137496984) has the molecular formula C30H27ClFN3O4 and a molecular weight of 548.01 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-cyclohexyl-2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-3-fluoroanilino)acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-cyclohexyl-2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-3-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 137496984 |
| Molecular Formula | C30H27ClFN3O4 |
| Molecular Weight | 548.01 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 2-(2-chlorophenyl)-N-cyclohexyl-2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-3-fluoroanilino)acetamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccccc1Cl)N(C(=O)CN1C(=O)c2ccccc2C1=O)c1cccc(F)c1 |
| InChI | InChI=1S/C30H27ClFN3O4/c31-25-16-7-6-15-24(25)27(28(37)33-20-10-2-1-3-11-20)35(21-12-8-9-19(32)17-21)26(36)18-34-29(38)22-13-4-5-14-23(22)30(34)39/h4-9,12-17,20,27H,1-3,10-11,18H2,(H,33,37) |
| InChIKey | GQCGWUYTUQHWKX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.01 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|