C23H25ClFN3O2 — CID 156686109
2-amino-N-[(1R)-1-(2-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-(3-fluorophenyl)prop-2-enamide (PubChem CID 156686109) has the molecular formula C23H25ClFN3O2 and a molecular weight of 429.92 g/mol. Its IUPAC name is 2-amino-N-[(1R)-1-(2-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-(3-fluorophenyl)prop-2-enamide.
| Compound Name | 2-amino-N-[(1R)-1-(2-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-(3-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 156686109 |
| Molecular Formula | C23H25ClFN3O2 |
| Molecular Weight | 429.92 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-amino-N-[(1R)-1-(2-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-(3-fluorophenyl)prop-2-enamide |
| SMILES | C=C(N)C(=O)N(c1cccc(F)c1)[C@@H](C(=O)NC1CCCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C23H25ClFN3O2/c1-15(26)23(30)28(18-11-7-8-16(25)14-18)21(19-12-5-6-13-20(19)24)22(29)27-17-9-3-2-4-10-17/h5-8,11-14,17,21H,1-4,9-10,26H2,(H,27,29)/t21-/m1/s1 |
| InChIKey | YWZGBLBBUIRCPZ-OAQYLSRUSA-N |
| XLogP | 4.47 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.92 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|