C24H21ClF4N2O2 — CID 58241204
N-[1-(2-chloro-4-fluorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide (PubChem CID 58241204) has the molecular formula C24H21ClF4N2O2 and a molecular weight of 480.89 g/mol. Its IUPAC name is N-[1-(2-chloro-4-fluorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide.
| Compound Name | N-[1-(2-chloro-4-fluorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 58241204 |
| Molecular Formula | C24H21ClF4N2O2 |
| Molecular Weight | 480.89 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N-[1-(2-chloro-4-fluorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide |
| SMILES | C#CC(=O)N(c1cccc(C(F)(F)F)c1)C(C(=O)NC1CCCCC1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C24H21ClF4N2O2/c1-2-21(32)31(18-10-6-7-15(13-18)24(27,28)29)22(19-12-11-16(26)14-20(19)25)23(33)30-17-8-4-3-5-9-17/h1,6-7,10-14,17,22H,3-5,8-9H2,(H,30,33) |
| InChIKey | LIENNVWONWFTKE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.89 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|