C24H21ClF3IN2O2 — CID 88945987
N-[1-(4-chloro-2-iodophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide (PubChem CID 88945987) has the molecular formula C24H21ClF3IN2O2 and a molecular weight of 588.80 g/mol. Its IUPAC name is N-[1-(4-chloro-2-iodophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide.
| Compound Name | N-[1-(4-chloro-2-iodophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 88945987 |
| Molecular Formula | C24H21ClF3IN2O2 |
| Molecular Weight | 588.80 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | N-[1-(4-chloro-2-iodophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide |
| SMILES | C#CC(=O)N(c1cccc(C(F)(F)F)c1)C(C(=O)NC1CCCCC1)c1ccc(Cl)cc1I |
| InChI | InChI=1S/C24H21ClF3IN2O2/c1-2-21(32)31(18-10-6-7-15(13-18)24(26,27)28)22(19-12-11-16(25)14-20(19)29)23(33)30-17-8-4-3-5-9-17/h1,6-7,10-14,17,22H,3-5,8-9H2,(H,30,33) |
| InChIKey | YYEJEKFJMUXIIL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.80 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|