C24H22F4N2O2 — CID 58241186
N-[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide (PubChem CID 58241186) has the molecular formula C24H22F4N2O2 and a molecular weight of 446.44 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide.
| Compound Name | N-[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 58241186 |
| Molecular Formula | C24H22F4N2O2 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]prop-2-ynamide |
| SMILES | C#CC(=O)N(c1cccc(C(F)(F)F)c1)C(C(=O)NC1CCCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22F4N2O2/c1-2-21(31)30(20-10-6-7-17(15-20)24(26,27)28)22(16-11-13-18(25)14-12-16)23(32)29-19-8-4-3-5-9-19/h1,6-7,10-15,19,22H,3-5,8-9H2,(H,29,32) |
| InChIKey | ODJDMZGKDWOQES-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|