C21H20F2N2O2S — CID 45107430
N-[2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3,4-difluorophenyl)prop-2-ynamide (PubChem CID 45107430) has the molecular formula C21H20F2N2O2S and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3,4-difluorophenyl)prop-2-ynamide.
| Compound Name | N-[2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3,4-difluorophenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 45107430 |
| Molecular Formula | C21H20F2N2O2S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3,4-difluorophenyl)prop-2-ynamide |
| SMILES | C#CC(=O)N(c1ccc(F)c(F)c1)C(C(=O)NC1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C21H20F2N2O2S/c1-2-19(26)25(15-10-11-16(22)17(23)13-15)20(18-9-6-12-28-18)21(27)24-14-7-4-3-5-8-14/h1,6,9-14,20H,3-5,7-8H2,(H,24,27) |
| InChIKey | SLFLLWPITFETEW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|