C22H26N2O4S — CID 89122668
N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)prop-2-ynamide (PubChem CID 89122668) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)prop-2-ynamide.
| Compound Name | N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)prop-2-ynamide |
|---|---|
| PubChem CID | 89122668 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)prop-2-ynamide |
| SMILES | C#CC(=O)N(C1=CCC(OC)C(OC)=C1)C(C(=O)NC1CCCC1)c1cccs1 |
| InChI | InChI=1S/C22H26N2O4S/c1-4-20(25)24(16-11-12-17(27-2)18(14-16)28-3)21(19-10-7-13-29-19)22(26)23-15-8-5-6-9-15/h1,7,10-11,13-15,17,21H,5-6,8-9,12H2,2-3H3,(H,23,26) |
| InChIKey | VWBCIKOXZVPMJB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|