C21H21N3O3S — CID 88945967
N-[2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-nitrosophenyl)prop-2-ynamide (PubChem CID 88945967) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-nitrosophenyl)prop-2-ynamide.
| Compound Name | N-[2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-nitrosophenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 88945967 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-nitrosophenyl)prop-2-ynamide |
| SMILES | C#CC(=O)N(c1cccc(N=O)c1)C(C(=O)NC1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C21H21N3O3S/c1-2-19(25)24(17-11-6-10-16(14-17)23-27)20(18-12-7-13-28-18)21(26)22-15-8-4-3-5-9-15/h1,6-7,10-15,20H,3-5,8-9H2,(H,22,26) |
| InChIKey | CNOKAXZSTBRRJM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|