C24H25N3O2S — CID 1439570
N-[(1R)-2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-phenylpyridine-2-carboxamide (PubChem CID 1439570) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[(1R)-2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-phenylpyridine-2-carboxamide.
| Compound Name | N-[(1R)-2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 1439570 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[(1R)-2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-N-phenylpyridine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@H](c1cccs1)N(C(=O)c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O2S/c28-23(26-18-10-3-1-4-11-18)22(21-15-9-17-30-21)27(19-12-5-2-6-13-19)24(29)20-14-7-8-16-25-20/h2,5-9,12-18,22H,1,3-4,10-11H2,(H,26,28)/t22-/m0/s1 |
| InChIKey | DNGNPUCBTKGKFO-QFIPXVFZSA-N |
| XLogP | 4.98 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |