C25H21N3O2S — CID 51687295
N-[(1S)-2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-N-phenylpyridine-2-carboxamide (PubChem CID 51687295) has the molecular formula C25H21N3O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[(1S)-2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-N-phenylpyridine-2-carboxamide.
| Compound Name | N-[(1S)-2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-N-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 51687295 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-[(1S)-2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-N-phenylpyridine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H](c1cccs1)N(C(=O)c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C25H21N3O2S/c29-24(27-18-19-10-3-1-4-11-19)23(22-15-9-17-31-22)28(20-12-5-2-6-13-20)25(30)21-14-7-8-16-26-21/h1-17,23H,18H2,(H,27,29)/t23-/m1/s1 |
| InChIKey | ODZKYPXHINVKCM-HSZRJFAPSA-N |
| XLogP | 4.85 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |