C30H23F3N2O2S — CID 45107396
N-[2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-3-phenyl-N-[3-(2,2,2-trifluoroethyl)phenyl]prop-2-ynamide (PubChem CID 45107396) has the molecular formula C30H23F3N2O2S and a molecular weight of 532.59 g/mol. Its IUPAC name is N-[2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-3-phenyl-N-[3-(2,2,2-trifluoroethyl)phenyl]prop-2-ynamide.
| Compound Name | N-[2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-3-phenyl-N-[3-(2,2,2-trifluoroethyl)phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 45107396 |
| Molecular Formula | C30H23F3N2O2S |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | N-[2-(benzylamino)-2-oxo-1-thiophen-2-ylethyl]-3-phenyl-N-[3-(2,2,2-trifluoroethyl)phenyl]prop-2-ynamide |
| SMILES | O=C(NCc1ccccc1)C(c1cccs1)N(C(=O)C#Cc1ccccc1)c1cccc(CC(F)(F)F)c1 |
| InChI | InChI=1S/C30H23F3N2O2S/c31-30(32,33)20-24-13-7-14-25(19-24)35(27(36)17-16-22-9-3-1-4-10-22)28(26-15-8-18-38-26)29(37)34-21-23-11-5-2-6-12-23/h1-15,18-19,28H,20-21H2,(H,34,37) |
| InChIKey | JXXAZUDQISPYTL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|