C24H22N4O2 — CID 166629964
N-(3-aminophenyl)-N-[1-(4-aminophenyl)-2-(benzylamino)-2-oxoethyl]prop-2-ynamide (PubChem CID 166629964) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N-(3-aminophenyl)-N-[1-(4-aminophenyl)-2-(benzylamino)-2-oxoethyl]prop-2-ynamide.
| Compound Name | N-(3-aminophenyl)-N-[1-(4-aminophenyl)-2-(benzylamino)-2-oxoethyl]prop-2-ynamide |
|---|---|
| PubChem CID | 166629964 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-(3-aminophenyl)-N-[1-(4-aminophenyl)-2-(benzylamino)-2-oxoethyl]prop-2-ynamide |
| SMILES | C#CC(=O)N(c1cccc(N)c1)C(C(=O)NCc1ccccc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C24H22N4O2/c1-2-22(29)28(21-10-6-9-20(26)15-21)23(18-11-13-19(25)14-12-18)24(30)27-16-17-7-4-3-5-8-17/h1,3-15,23H,16,25-26H2,(H,27,30) |
| InChIKey | PAXFVFYPXZMWNX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|