C26H23N3O4 — CID 166634044
methyl 4-[[1-(3-aminophenyl)-2-(benzylamino)-2-oxoethyl]-prop-2-ynoylamino]benzoate (PubChem CID 166634044) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is methyl 4-[[1-(3-aminophenyl)-2-(benzylamino)-2-oxoethyl]-prop-2-ynoylamino]benzoate.
| Compound Name | methyl 4-[[1-(3-aminophenyl)-2-(benzylamino)-2-oxoethyl]-prop-2-ynoylamino]benzoate |
|---|---|
| PubChem CID | 166634044 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | methyl 4-[[1-(3-aminophenyl)-2-(benzylamino)-2-oxoethyl]-prop-2-ynoylamino]benzoate |
| SMILES | C#CC(=O)N(c1ccc(C(=O)OC)cc1)C(C(=O)NCc1ccccc1)c1cccc(N)c1 |
| InChI | InChI=1S/C26H23N3O4/c1-3-23(30)29(22-14-12-19(13-15-22)26(32)33-2)24(20-10-7-11-21(27)16-20)25(31)28-17-18-8-5-4-6-9-18/h1,4-16,24H,17,27H2,2H3,(H,28,31) |
| InChIKey | USWCXQKNLCYBPO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|