C23H26N4O3 — CID 166631914
N-(4-acetamidophenyl)-N-[1-(3-aminophenyl)-2-(tert-butylamino)-2-oxoethyl]prop-2-ynamide (PubChem CID 166631914) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-N-[1-(3-aminophenyl)-2-(tert-butylamino)-2-oxoethyl]prop-2-ynamide.
| Compound Name | N-(4-acetamidophenyl)-N-[1-(3-aminophenyl)-2-(tert-butylamino)-2-oxoethyl]prop-2-ynamide |
|---|---|
| PubChem CID | 166631914 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-(4-acetamidophenyl)-N-[1-(3-aminophenyl)-2-(tert-butylamino)-2-oxoethyl]prop-2-ynamide |
| SMILES | C#CC(=O)N(c1ccc(NC(C)=O)cc1)C(C(=O)NC(C)(C)C)c1cccc(N)c1 |
| InChI | InChI=1S/C23H26N4O3/c1-6-20(29)27(19-12-10-18(11-13-19)25-15(2)28)21(22(30)26-23(3,4)5)16-8-7-9-17(24)14-16/h1,7-14,21H,24H2,2-5H3,(H,25,28)(H,26,30) |
| InChIKey | STAWJRUYGBGFPG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|