C25H22ClN3O3 — CID 166634980
N-[1-(3-aminophenyl)-2-(benzylamino)-2-oxoethyl]-N-(3-chloro-4-methoxyphenyl)prop-2-ynamide (PubChem CID 166634980) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is N-[1-(3-aminophenyl)-2-(benzylamino)-2-oxoethyl]-N-(3-chloro-4-methoxyphenyl)prop-2-ynamide.
| Compound Name | N-[1-(3-aminophenyl)-2-(benzylamino)-2-oxoethyl]-N-(3-chloro-4-methoxyphenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 166634980 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[1-(3-aminophenyl)-2-(benzylamino)-2-oxoethyl]-N-(3-chloro-4-methoxyphenyl)prop-2-ynamide |
| SMILES | C#CC(=O)N(c1ccc(OC)c(Cl)c1)C(C(=O)NCc1ccccc1)c1cccc(N)c1 |
| InChI | InChI=1S/C25H22ClN3O3/c1-3-23(30)29(20-12-13-22(32-2)21(26)15-20)24(18-10-7-11-19(27)14-18)25(31)28-16-17-8-5-4-6-9-17/h1,4-15,24H,16,27H2,2H3,(H,28,31) |
| InChIKey | JDNUTJOFWYORHE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|