C25H23ClN2O4S — CID 166630408
N-(3-chloro-4-methoxyphenyl)-4-hydroxy-N-[2-oxo-2-(2-phenylethylamino)-1-thiophen-2-ylethyl]but-2-ynamide (PubChem CID 166630408) has the molecular formula C25H23ClN2O4S and a molecular weight of 482.99 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-hydroxy-N-[2-oxo-2-(2-phenylethylamino)-1-thiophen-2-ylethyl]but-2-ynamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-hydroxy-N-[2-oxo-2-(2-phenylethylamino)-1-thiophen-2-ylethyl]but-2-ynamide |
|---|---|
| PubChem CID | 166630408 |
| Molecular Formula | C25H23ClN2O4S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-hydroxy-N-[2-oxo-2-(2-phenylethylamino)-1-thiophen-2-ylethyl]but-2-ynamide |
| SMILES | COc1ccc(N(C(=O)C#CCO)C(C(=O)NCCc2ccccc2)c2cccs2)cc1Cl |
| InChI | InChI=1S/C25H23ClN2O4S/c1-32-21-12-11-19(17-20(21)26)28(23(30)10-5-15-29)24(22-9-6-16-33-22)25(31)27-14-13-18-7-3-2-4-8-18/h2-4,6-9,11-12,16-17,24,29H,13-15H2,1H3,(H,27,31) |
| InChIKey | ATGZFGHGQPWTJC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|