C16H17ClN2O2S — CID 175945806
2-[(2-chloroacetyl)amino]-N-(2-phenylethyl)-2-thiophen-2-ylacetamide (PubChem CID 175945806) has the molecular formula C16H17ClN2O2S and a molecular weight of 336.84 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)amino]-N-(2-phenylethyl)-2-thiophen-2-ylacetamide.
| Compound Name | 2-[(2-chloroacetyl)amino]-N-(2-phenylethyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 175945806 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[(2-chloroacetyl)amino]-N-(2-phenylethyl)-2-thiophen-2-ylacetamide |
| SMILES | O=C(CCl)NC(C(=O)NCCc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C16H17ClN2O2S/c17-11-14(20)19-15(13-7-4-10-22-13)16(21)18-9-8-12-5-2-1-3-6-12/h1-7,10,15H,8-9,11H2,(H,18,21)(H,19,20) |
| InChIKey | JNJLBOKPWGMNMH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|