C12H19Cl2NO — CID 174557988
2-methyl-N-(2-phenylethyl)propanamide;dihydrochloride (PubChem CID 174557988) has the molecular formula C12H19Cl2NO and a molecular weight of 264.20 g/mol. Its IUPAC name is 2-methyl-N-(2-phenylethyl)propanamide;dihydrochloride.
| Compound Name | 2-methyl-N-(2-phenylethyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 174557988 |
| Molecular Formula | C12H19Cl2NO |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-methyl-N-(2-phenylethyl)propanamide;dihydrochloride |
| SMILES | CC(C)C(=O)NCCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C12H17NO.2ClH/c1-10(2)12(14)13-9-8-11-6-4-3-5-7-11;;/h3-7,10H,8-9H2,1-2H3,(H,13,14);2*1H |
| InChIKey | MNNRGPCHEOHREV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |