About N-benzyl-2-methylpropanamide;methane
N-benzyl-2-methylpropanamide;methane (PubChem CID 160760567) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is N-benzyl-2-methylpropanamide;methane.
Molecular Properties
| Compound Name | N-benzyl-2-methylpropanamide;methane |
| PubChem CID | 160760567 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-benzyl-2-methylpropanamide;methane |
| SMILES | C.C.CC(C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C11H15NO.2CH4/c1-9(2)11(13)12-8-10-6-4-3-5-7-10;;/h3-7,9H,8H2,1-2H3,(H,12,13);2*1H4 |
| InChIKey | RXZWNZOZOKGUPQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-2-methylpropanamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-methylpropanamide;methane?
The IUPAC name of N-benzyl-2-methylpropanamide;methane (CID 160760567) is N-benzyl-2-methylpropanamide;methane.
What is the SMILES notation for N-benzyl-2-methylpropanamide;methane?
The canonical SMILES for N-benzyl-2-methylpropanamide;methane is C.C.CC(C)C(=O)NCc1ccccc1.
What is the InChIKey of N-benzyl-2-methylpropanamide;methane?
The InChIKey is RXZWNZOZOKGUPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.2CH4/c1-9(2)11(13)12-8-10-6-4-3-5-7-10;;/h3-7,9H,8H2,1-2H3,(H,12,13);2*1H4.
What are the key properties of N-benzyl-2-methylpropanamide;methane?
N-benzyl-2-methylpropanamide;methane has a molecular weight of 209.33 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-methylpropanamide;methane is sourced from PubChem (CID 160760567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).