C11H17N3O2 — CID 71428235
(2S,3R)-N-benzyl-3-hydrazinyl-2-hydroxybutanamide (PubChem CID 71428235) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is (2S,3R)-N-benzyl-3-hydrazinyl-2-hydroxybutanamide.
| Compound Name | (2S,3R)-N-benzyl-3-hydrazinyl-2-hydroxybutanamide |
|---|---|
| PubChem CID | 71428235 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | (2S,3R)-N-benzyl-3-hydrazinyl-2-hydroxybutanamide |
| SMILES | C[C@@H](NN)[C@H](O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C11H17N3O2/c1-8(14-12)10(15)11(16)13-7-9-5-3-2-4-6-9/h2-6,8,10,14-15H,7,12H2,1H3,(H,13,16)/t8-,10+/m1/s1 |
| InChIKey | YNLHOBFZMMBGNA-SCZZXKLOSA-N |
| XLogP | -0.48 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|