C13H17NO3 — CID 70849144
N-benzyl-3-cyclopropyl-2,3-dihydroxypropanamide (PubChem CID 70849144) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-benzyl-3-cyclopropyl-2,3-dihydroxypropanamide.
| Compound Name | N-benzyl-3-cyclopropyl-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 70849144 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-benzyl-3-cyclopropyl-2,3-dihydroxypropanamide |
| SMILES | O=C(NCc1ccccc1)C(O)C(O)C1CC1 |
| InChI | InChI=1S/C13H17NO3/c15-11(10-6-7-10)12(16)13(17)14-8-9-4-2-1-3-5-9/h1-5,10-12,15-16H,6-8H2,(H,14,17) |
| InChIKey | RPHGTYIJBCEVKH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |