C16H17NO3 — CID 71048663
(2S,3R)-N-benzyl-2,3-dihydroxy-3-phenylpropanamide (PubChem CID 71048663) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2S,3R)-N-benzyl-2,3-dihydroxy-3-phenylpropanamide.
| Compound Name | (2S,3R)-N-benzyl-2,3-dihydroxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 71048663 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (2S,3R)-N-benzyl-2,3-dihydroxy-3-phenylpropanamide |
| SMILES | O=C(NCc1ccccc1)[C@@H](O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO3/c18-14(13-9-5-2-6-10-13)15(19)16(20)17-11-12-7-3-1-4-8-12/h1-10,14-15,18-19H,11H2,(H,17,20)/t14-,15+/m1/s1 |
| InChIKey | MZVHFVSNJUYCQB-CABCVRRESA-N |
| XLogP | 1.40 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |