C17H16N2O3S — CID 110879660
3-(1,3-benzothiazol-2-yl)-N-benzyl-2,3-dihydroxypropanamide (PubChem CID 110879660) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-benzyl-2,3-dihydroxypropanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-benzyl-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 110879660 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-benzyl-2,3-dihydroxypropanamide |
| SMILES | O=C(NCc1ccccc1)C(O)C(O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H16N2O3S/c20-14(16(22)18-10-11-6-2-1-3-7-11)15(21)17-19-12-8-4-5-9-13(12)23-17/h1-9,14-15,20-21H,10H2,(H,18,22) |
| InChIKey | YKZFOTZUBQBHJG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |