C24H18N2O3S — CID 112811668
3-(1,3-benzothiazol-2-yl)-2,3-dihydroxy-N-[3-(2-phenylethynyl)phenyl]propanamide (PubChem CID 112811668) has the molecular formula C24H18N2O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-2,3-dihydroxy-N-[3-(2-phenylethynyl)phenyl]propanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-2,3-dihydroxy-N-[3-(2-phenylethynyl)phenyl]propanamide |
|---|---|
| PubChem CID | 112811668 |
| Molecular Formula | C24H18N2O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-2,3-dihydroxy-N-[3-(2-phenylethynyl)phenyl]propanamide |
| SMILES | O=C(Nc1cccc(C#Cc2ccccc2)c1)C(O)C(O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H18N2O3S/c27-21(22(28)24-26-19-11-4-5-12-20(19)30-24)23(29)25-18-10-6-9-17(15-18)14-13-16-7-2-1-3-8-16/h1-12,15,21-22,27-28H,(H,25,29) |
| InChIKey | YBHZZRGGEDUJEY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|