C18H24N2O3S — CID 110015940
3-(1,3-benzothiazol-2-yl)-N-(1-cyclohexylethyl)-2,3-dihydroxypropanamide (PubChem CID 110015940) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-(1-cyclohexylethyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-(1-cyclohexylethyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 110015940 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-(1-cyclohexylethyl)-2,3-dihydroxypropanamide |
| SMILES | CC(NC(=O)C(O)C(O)c1nc2ccccc2s1)C1CCCCC1 |
| InChI | InChI=1S/C18H24N2O3S/c1-11(12-7-3-2-4-8-12)19-17(23)15(21)16(22)18-20-13-9-5-6-10-14(13)24-18/h5-6,9-12,15-16,21-22H,2-4,7-8H2,1H3,(H,19,23) |
| InChIKey | ADKFKBRYJNJURV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |