C17H23N3OS — CID 25487919
(2R)-2-(1,3-benzothiazol-2-ylamino)-N-cycloheptylpropanamide (PubChem CID 25487919) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is (2R)-2-(1,3-benzothiazol-2-ylamino)-N-cycloheptylpropanamide.
| Compound Name | (2R)-2-(1,3-benzothiazol-2-ylamino)-N-cycloheptylpropanamide |
|---|---|
| PubChem CID | 25487919 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (2R)-2-(1,3-benzothiazol-2-ylamino)-N-cycloheptylpropanamide |
| SMILES | C[C@@H](Nc1nc2ccccc2s1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C17H23N3OS/c1-12(16(21)19-13-8-4-2-3-5-9-13)18-17-20-14-10-6-7-11-15(14)22-17/h6-7,10-13H,2-5,8-9H2,1H3,(H,18,20)(H,19,21)/t12-/m1/s1 |
| InChIKey | UHVGTPZCXONBBF-GFCCVEGCSA-N |
| XLogP | 3.94 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |