C18H24N4O2S — CID 16614965
N-(1,3-benzothiazol-2-yl)-4-(cyclohexylcarbamoylamino)butanamide (PubChem CID 16614965) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-(cyclohexylcarbamoylamino)butanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-(cyclohexylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 16614965 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-(cyclohexylcarbamoylamino)butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H24N4O2S/c23-16(22-18-21-14-9-4-5-10-15(14)25-18)11-6-12-19-17(24)20-13-7-2-1-3-8-13/h4-5,9-10,13H,1-3,6-8,11-12H2,(H2,19,20,24)(H,21,22,23) |
| InChIKey | MMXQWFXZNDBAIH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|