C13H13N2O3S- — CID 2063722
6-(1,3-benzothiazol-2-ylamino)-6-oxohexanoate (PubChem CID 2063722) has the molecular formula C13H13N2O3S- and a molecular weight of 277.32 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-ylamino)-6-oxohexanoate.
| Compound Name | 6-(1,3-benzothiazol-2-ylamino)-6-oxohexanoate |
|---|---|
| PubChem CID | 2063722 |
| Molecular Formula | C13H13N2O3S- |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 6-(1,3-benzothiazol-2-ylamino)-6-oxohexanoate |
| SMILES | O=C([O-])CCCCC(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H14N2O3S/c16-11(7-3-4-8-12(17)18)15-13-14-9-5-1-2-6-10(9)19-13/h1-2,5-6H,3-4,7-8H2,(H,17,18)(H,14,15,16)/p-1 |
| InChIKey | KUIGXJGQENXXEB-UHFFFAOYSA-M |
| XLogP | 1.55 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|