C10H9N3OS2 — CID 43120469
3-amino-N-(1,3-benzothiazol-2-yl)-3-sulfanylidenepropanamide (PubChem CID 43120469) has the molecular formula C10H9N3OS2 and a molecular weight of 251.34 g/mol. Its IUPAC name is 3-amino-N-(1,3-benzothiazol-2-yl)-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(1,3-benzothiazol-2-yl)-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 43120469 |
| Molecular Formula | C10H9N3OS2 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 3-amino-N-(1,3-benzothiazol-2-yl)-3-sulfanylidenepropanamide |
| SMILES | NC(=S)CC(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C10H9N3OS2/c11-8(15)5-9(14)13-10-12-6-3-1-2-4-7(6)16-10/h1-4H,5H2,(H2,11,15)(H,12,13,14) |
| InChIKey | XAPFVMQGXAOSFV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|