C8H5N2NaS3 — CID 23699803
sodium N-(1,3-benzothiazol-2-yl)carbamodithioate (PubChem CID 23699803) has the molecular formula C8H5N2NaS3 and a molecular weight of 248.33 g/mol. Its IUPAC name is sodium N-(1,3-benzothiazol-2-yl)carbamodithioate.
| Compound Name | sodium N-(1,3-benzothiazol-2-yl)carbamodithioate |
|---|---|
| PubChem CID | 23699803 |
| Molecular Formula | C8H5N2NaS3 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | sodium N-(1,3-benzothiazol-2-yl)carbamodithioate |
| SMILES | S=C([S-])Nc1nc2ccccc2s1.[Na+] |
| InChI | InChI=1S/C8H6N2S3.Na/c11-8(12)10-7-9-5-3-1-2-4-6(5)13-7;/h1-4H,(H2,9,10,11,12);/q;+1/p-1 |
| InChIKey | ZHANNHVVNADESS-UHFFFAOYSA-M |
| XLogP | -0.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|