C22H20N4O2S2 — CID 171722456
1-N,4-N-bis(1,3-benzothiazol-2-yl)cyclohexane-1,4-dicarboxamide (PubChem CID 171722456) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-N,4-N-bis(1,3-benzothiazol-2-yl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(1,3-benzothiazol-2-yl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 171722456 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-N,4-N-bis(1,3-benzothiazol-2-yl)cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)C1CCC(C(=O)Nc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C22H20N4O2S2/c27-19(25-21-23-15-5-1-3-7-17(15)29-21)13-9-11-14(12-10-13)20(28)26-22-24-16-6-2-4-8-18(16)30-22/h1-8,13-14H,9-12H2,(H,23,25,27)(H,24,26,28) |
| InChIKey | PUPVVBBAPZNNMB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |