C21H21N3O2S — CID 8882216
N-(1,3-benzothiazol-2-yl)-1-(2-methylbenzoyl)piperidine-4-carboxamide (PubChem CID 8882216) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-1-(2-methylbenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-1-(2-methylbenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 8882216 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-1-(2-methylbenzoyl)piperidine-4-carboxamide |
| SMILES | Cc1ccccc1C(=O)N1CCC(C(=O)Nc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H21N3O2S/c1-14-6-2-3-7-16(14)20(26)24-12-10-15(11-13-24)19(25)23-21-22-17-8-4-5-9-18(17)27-21/h2-9,15H,10-13H2,1H3,(H,22,23,25) |
| InChIKey | ZRBLYVBCOQOPNE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |