C16H10N4O2S2 — CID 591706
N,N'-bis(1,3-benzothiazol-2-yl)oxamide (PubChem CID 591706) has the molecular formula C16H10N4O2S2 and a molecular weight of 354.42 g/mol. Its IUPAC name is N,N'-bis(1,3-benzothiazol-2-yl)oxamide.
| Compound Name | N,N'-bis(1,3-benzothiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 591706 |
| Molecular Formula | C16H10N4O2S2 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | N,N'-bis(1,3-benzothiazol-2-yl)oxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H10N4O2S2/c21-13(19-15-17-9-5-1-3-7-11(9)23-15)14(22)20-16-18-10-6-2-4-8-12(10)24-16/h1-8H,(H,17,19,21)(H,18,20,22) |
| InChIKey | YKRNHPCAFHIKTG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|