C16H12N4O3S — CID 135822245
N-(1,3-benzothiazol-2-yl)-N'-[(E)-(2-hydroxyphenyl)methylideneamino]oxamide (PubChem CID 135822245) has the molecular formula C16H12N4O3S and a molecular weight of 340.36 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N'-[(E)-(2-hydroxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N'-[(E)-(2-hydroxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 135822245 |
| Molecular Formula | C16H12N4O3S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N'-[(E)-(2-hydroxyphenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1ccccc1O)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H12N4O3S/c21-12-7-3-1-5-10(12)9-17-20-15(23)14(22)19-16-18-11-6-2-4-8-13(11)24-16/h1-9,21H,(H,20,23)(H,18,19,22)/b17-9+ |
| InChIKey | BXSXREXWXNEASR-RQZCQDPDSA-N |
| XLogP | 2.09 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|