C28H22CdN6O2S2 — CID 135466896
bis(2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenol);cadmium (PubChem CID 135466896) has the molecular formula C28H22CdN6O2S2 and a molecular weight of 651.07 g/mol. Its IUPAC name is bis(2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenol);cadmium.
| Compound Name | bis(2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenol);cadmium |
|---|---|
| PubChem CID | 135466896 |
| Molecular Formula | C28H22CdN6O2S2 |
| Molecular Weight | 651.07 g/mol |
| Exact Mass | 652.03 |
| IUPAC Name | bis(2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenol);cadmium |
| SMILES | Oc1ccccc1/C=N/Nc1nc2ccccc2s1.Oc1ccccc1/C=N/Nc1nc2ccccc2s1.[Cd] |
| InChI | InChI=1S/2C14H11N3OS.Cd/c2*18-12-7-3-1-5-10(12)9-15-17-14-16-11-6-2-4-8-13(11)19-14;/h2*1-9,18H,(H,16,17);/b2*15-9+; |
| InChIKey | FCNXXFCGJKOZQL-CGZWKZIFSA-N |
| XLogP | 6.89 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.07 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|