C24H17N5OS — CID 137059830
2-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(naphthalen-1-yldiazenyl)phenol (PubChem CID 137059830) has the molecular formula C24H17N5OS and a molecular weight of 423.50 g/mol. Its IUPAC name is 2-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(naphthalen-1-yldiazenyl)phenol.
| Compound Name | 2-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(naphthalen-1-yldiazenyl)phenol |
|---|---|
| PubChem CID | 137059830 |
| Molecular Formula | C24H17N5OS |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(naphthalen-1-yldiazenyl)phenol |
| SMILES | Oc1ccc(/N=N/c2cccc3ccccc23)cc1/C=N\Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C24H17N5OS/c30-22-13-12-18(27-28-20-10-5-7-16-6-1-2-8-19(16)20)14-17(22)15-25-29-24-26-21-9-3-4-11-23(21)31-24/h1-15,30H,(H,26,29)/b25-15-,28-27+ |
| InChIKey | PMDSVQXVASUUMR-IOMOAXKRSA-N |
| XLogP | 7.02 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|