C24H19N5O2 — CID 135464584
4-amino-N-[(Z)-[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylideneamino]benzamide (PubChem CID 135464584) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-amino-N-[(Z)-[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylideneamino]benzamide.
| Compound Name | 4-amino-N-[(Z)-[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135464584 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-amino-N-[(Z)-[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylideneamino]benzamide |
| SMILES | Nc1ccc(C(=O)N/N=C\c2cc(/N=N/c3cccc4ccccc34)ccc2O)cc1 |
| InChI | InChI=1S/C24H19N5O2/c25-19-10-8-17(9-11-19)24(31)29-26-15-18-14-20(12-13-23(18)30)27-28-22-7-3-5-16-4-1-2-6-21(16)22/h1-15,30H,25H2,(H,29,31)/b26-15-,28-27+ |
| InChIKey | DQKGBPUXEVJYAB-BBTJEBRRSA-N |
| XLogP | 5.31 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|