C25H18N4O4 — CID 135897013
N-[(Z)-[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 135897013) has the molecular formula C25H18N4O4 and a molecular weight of 438.44 g/mol. Its IUPAC name is N-[(Z)-[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(Z)-[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 135897013 |
| Molecular Formula | C25H18N4O4 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-[(Z)-[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(N/N=C\c1cc(/N=N/c2cccc3ccccc23)ccc1O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H18N4O4/c30-22-10-9-19(27-28-21-7-3-5-16-4-1-2-6-20(16)21)12-18(22)14-26-29-25(31)17-8-11-23-24(13-17)33-15-32-23/h1-14,30H,15H2,(H,29,31)/b26-14-,28-27+ |
| InChIKey | UGQHQCGBYGSANT-KCWSSEAOSA-N |
| XLogP | 5.45 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|