C20H16N2O3 — CID 5056514
N-(naphthalen-1-ylmethylideneamino)-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 5056514) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-(naphthalen-1-ylmethylideneamino)-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-(naphthalen-1-ylmethylideneamino)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 5056514 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-(naphthalen-1-ylmethylideneamino)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(NN=Cc1cccc2ccccc12)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H16N2O3/c23-20(15-8-9-18-19(12-15)25-11-10-24-18)22-21-13-16-6-3-5-14-4-1-2-7-17(14)16/h1-9,12-13H,10-11H2,(H,22,23) |
| InChIKey | XXMYZQJLRNURMF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|