C15H12N2O3 — CID 834948
N-(benzylideneamino)-1,3-benzodioxole-5-carboxamide (PubChem CID 834948) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is N-(benzylideneamino)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(benzylideneamino)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 834948 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(benzylideneamino)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12N2O3/c18-15(17-16-9-11-4-2-1-3-5-11)12-6-7-13-14(8-12)20-10-19-13/h1-9H,10H2,(H,17,18) |
| InChIKey | HRIRAUIMKLPPRU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|