C18H14N4O6 — CID 7303308
N-[(E)-[(2E)-2-(1,3-benzodioxole-5-carbonylhydrazinylidene)ethylidene]amino]-1,3-benzodioxole-5-carboxamide (PubChem CID 7303308) has the molecular formula C18H14N4O6 and a molecular weight of 382.33 g/mol. Its IUPAC name is N-[(E)-[(2E)-2-(1,3-benzodioxole-5-carbonylhydrazinylidene)ethylidene]amino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(E)-[(2E)-2-(1,3-benzodioxole-5-carbonylhydrazinylidene)ethylidene]amino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 7303308 |
| Molecular Formula | C18H14N4O6 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[(E)-[(2E)-2-(1,3-benzodioxole-5-carbonylhydrazinylidene)ethylidene]amino]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(N/N=C/C=N/NC(=O)c1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H14N4O6/c23-17(11-1-3-13-15(7-11)27-9-25-13)21-19-5-6-20-22-18(24)12-2-4-14-16(8-12)28-10-26-14/h1-8H,9-10H2,(H,21,23)(H,22,24)/b19-5+,20-6+ |
| InChIKey | MDRDOKKOYPKKHL-OGBZJDJUSA-N |
| XLogP | 1.28 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|