C13H8Br2N2O4 — CID 5497765
N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 5497765) has the molecular formula C13H8Br2N2O4 and a molecular weight of 416.03 g/mol. Its IUPAC name is N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 5497765 |
| Molecular Formula | C13H8Br2N2O4 |
| Molecular Weight | 416.03 g/mol |
| Exact Mass | 413.89 |
| IUPAC Name | N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Br)c(Br)o1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H8Br2N2O4/c14-9-4-8(21-12(9)15)5-16-17-13(18)7-1-2-10-11(3-7)20-6-19-10/h1-5H,6H2,(H,17,18)/b16-5- |
| InChIKey | FVWGUHAZGGHVOD-BNCCVWRVSA-N |
| XLogP | 3.30 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.03 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|