C14H11Br2N3O3 — CID 4675138
3-acetamido-N-[(4,5-dibromofuran-2-yl)methylideneamino]benzamide (PubChem CID 4675138) has the molecular formula C14H11Br2N3O3 and a molecular weight of 429.07 g/mol. Its IUPAC name is 3-acetamido-N-[(4,5-dibromofuran-2-yl)methylideneamino]benzamide.
| Compound Name | 3-acetamido-N-[(4,5-dibromofuran-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4675138 |
| Molecular Formula | C14H11Br2N3O3 |
| Molecular Weight | 429.07 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | 3-acetamido-N-[(4,5-dibromofuran-2-yl)methylideneamino]benzamide |
| SMILES | CC(=O)Nc1cccc(C(=O)NN=Cc2cc(Br)c(Br)o2)c1 |
| InChI | InChI=1S/C14H11Br2N3O3/c1-8(20)18-10-4-2-3-9(5-10)14(21)19-17-7-11-6-12(15)13(16)22-11/h2-7H,1H3,(H,18,20)(H,19,21) |
| InChIKey | JMGWOZCMDZDUSV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.07 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|