C14H12N4O4S — CID 6026824
3-acetamido-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 6026824) has the molecular formula C14H12N4O4S and a molecular weight of 332.34 g/mol. Its IUPAC name is 3-acetamido-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 3-acetamido-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6026824 |
| Molecular Formula | C14H12N4O4S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 3-acetamido-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | CC(=O)Nc1cccc(C(=O)N/N=C\c2ccc([N+](=O)[O-])s2)c1 |
| InChI | InChI=1S/C14H12N4O4S/c1-9(19)16-11-4-2-3-10(7-11)14(20)17-15-8-12-5-6-13(23-12)18(21)22/h2-8H,1H3,(H,16,19)(H,17,20)/b15-8- |
| InChIKey | WBCWKRGWAVLCOH-NVNXTCNLSA-N |
| XLogP | 2.38 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|