C19H13FN4O4S — CID 86809549
4-[(4-fluorobenzoyl)amino]-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 86809549) has the molecular formula C19H13FN4O4S and a molecular weight of 412.40 g/mol. Its IUPAC name is 4-[(4-fluorobenzoyl)amino]-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 4-[(4-fluorobenzoyl)amino]-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 86809549 |
| Molecular Formula | C19H13FN4O4S |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 4-[(4-fluorobenzoyl)amino]-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc([N+](=O)[O-])s1)c1ccc(NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H13FN4O4S/c20-14-5-1-12(2-6-14)18(25)22-15-7-3-13(4-8-15)19(26)23-21-11-16-9-10-17(29-16)24(27)28/h1-11H,(H,22,25)(H,23,26)/b21-11+ |
| InChIKey | XWSXDHDIBHOHTA-SRZZPIQSSA-N |
| XLogP | 3.81 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|