C19H13ClN4O4S — CID 171135913
2-chloro-N-[4-[[(5-nitrothiophen-2-yl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 171135913) has the molecular formula C19H13ClN4O4S and a molecular weight of 428.86 g/mol. Its IUPAC name is 2-chloro-N-[4-[[(5-nitrothiophen-2-yl)methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[4-[[(5-nitrothiophen-2-yl)methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 171135913 |
| Molecular Formula | C19H13ClN4O4S |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 2-chloro-N-[4-[[(5-nitrothiophen-2-yl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | O=C(NN=Cc1ccc([N+](=O)[O-])s1)c1ccc(NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H13ClN4O4S/c20-16-4-2-1-3-15(16)19(26)22-13-7-5-12(6-8-13)18(25)23-21-11-14-9-10-17(29-14)24(27)28/h1-11H,(H,22,26)(H,23,25) |
| InChIKey | VNGCVEOHDZHUAD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|