C19H13N5O6S — CID 171136003
3-[(3-nitrobenzoyl)amino]-N-[(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 171136003) has the molecular formula C19H13N5O6S and a molecular weight of 439.41 g/mol. Its IUPAC name is 3-[(3-nitrobenzoyl)amino]-N-[(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 3-[(3-nitrobenzoyl)amino]-N-[(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 171136003 |
| Molecular Formula | C19H13N5O6S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 3-[(3-nitrobenzoyl)amino]-N-[(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccc([N+](=O)[O-])s1)c1cccc(NC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H13N5O6S/c25-18(13-4-2-6-15(10-13)23(27)28)21-14-5-1-3-12(9-14)19(26)22-20-11-16-7-8-17(31-16)24(29)30/h1-11H,(H,21,25)(H,22,26) |
| InChIKey | QIZVKOAVWMWYGP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|